ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7090 CAS 1211588-96-3



5-BROMO-2-IODO-1-(PHENYLSULFONYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1211588-96-3
ID 7090

Molecular Formula   C13H8BrIN2O2S
Molecular Weight     463.087
SmileCode               C1=CC=C(C=C1)S(=O)(=O)N2C(=CC3=CC(=CN=C32)Br)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com