ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7092 CAS 1217674-57-1



(RAC-TRANS)-1-TERT-BUTYL 3-METHYL 4-(5,6-DIMETHOXYPYRIDIN-2-YL)PYRROLIDINE-1,3-DICARBOXYLATE
CAS 1217674-57-1
ID 7092

Molecular Formula   C18H26N2O6
Molecular Weight     366.414
SmileCode               CC(C)(C)OC(=O)N1CC(C(C1)C(=O)OC)C2=NC(=C(C=C2)OC)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com