ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7095 CAS 1222533-72-3



2-(DIMETHOXYMETHYL)-6-FLUORO-1,8-NAPHTHYRIDINE
CAS 1222533-72-3
ID 7095

Molecular Formula   C11H11FN2O2
Molecular Weight     222.219
SmileCode               COC(C1=NC2=NC=C(C=C2C=C1)F)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com