ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7102 CAS 1222533-81-4



(E)-METHYL 3-(8-PIVALOYL-5,6,7,8-TETRAHYDRO-1,8-NAPHTHYRIDIN-3-YL)ACRYLATE
CAS 1222533-81-4
ID 7102

Molecular Formula   C17H22N2O3
Molecular Weight     302.374
SmileCode               CC(C)(C)C(=O)N1CCCC2=C1N=CC(=C2)C=CC(=O)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com