ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7105 CAS 1222533-85-8



1-(5-METHYL-1H-PYRROLO[2,3-B]PYRIDIN-3-YL)ETHANONE
CAS 1222533-85-8
ID 7105

Molecular Formula   C10H10N2O
Molecular Weight     174.203
SmileCode               CC1=CN=C2C(=C1)C(=CN2)C(=O)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com