ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7106 CAS 1222533-87-0



1,1'-(5-METHYL-1H-PYRROLO[2,3-B]PYRIDINE-1,3-DIYL)DIETHANONE
CAS 1222533-87-0
ID 7106

Molecular Formula   C12H12N2O2
Molecular Weight     216.240
SmileCode               CC1=CN=C2C(=C1)C(=CN2C(=O)C)C(=O)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com