ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7110 CAS 1222533-93-8



6-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-3,4-DIHYDRO-2H-PYRANO[2,3-B]PYRIDINE
CAS 1222533-93-8
ID 7110

Molecular Formula   C14H20BNO3
Molecular Weight     261.128
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(N=C2)OCCC3

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com