ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7111 CAS 1222533-94-9



6,8-DIIODO-3,4-DIHYDRO-2H-PYRANO[3,2-B]PYRIDINE
CAS 1222533-94-9
ID 7111

Molecular Formula   C8H7I2NO
Molecular Weight     386.959
SmileCode               C1CC2=C(C(=CC(=N2)I)I)OC1

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com