ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7115 CAS 122684-34-8



3-CARBAMOYL-PYRROLIDINE-1-CARBOXYLIC ACID TERT-BUTYL ESTER
CAS 122684-34-8
ID 7115

Molecular Formula   C10H18N2O3
Molecular Weight     214.265
SmileCode               CC(C)(C)OC(=O)N1CCC(C1)C(=O)N

Quantity | Price        5g | 940 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com