ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7120 CAS 1228070-72-1



(RACEMIC TRANS)-1-TERT-BUTYL 3-METHYL 4-(2-CHLORO-5-METHYLPYRIDIN-3-YL)PYRROLIDINE-1,3-DICARBOXYLATE
CAS 1228070-72-1
ID 7120

Molecular Formula   C17H23ClN2O4
Molecular Weight     354.831
SmileCode               CC1=CN=C(C(=C1)C2CN(CC2C(=O)OC)C(=O)OC(C)(C)C)Cl

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com