ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7122 CAS 1228665-50-6



(6-(3-((TERT-BUTYLDIMETHYLSILYLOXY)METHYL)PYRROLIDIN-1-YL)-2-FLUOROPYRIDIN-3-YL)METHANOL
CAS 1228665-50-6
ID 7122

Molecular Formula   C17H29FN2O2Si
Molecular Weight     340.514
SmileCode               CC(C)(C)[Si](C)(C)OCC1CCN(C1)C2=NC(=C(C=C2)CO)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com