ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7124 CAS 1228665-70-0



N-(3-(3-(TERT-BUTYLDIMETHYLSILYLOXY)PROPYL)PYRIDIN-2-YL)PIVALAMIDE
CAS 1228665-70-0
ID 7124

Molecular Formula   C19H34N2O2Si
Molecular Weight     350.578
SmileCode               CC(C)(C)C(=O)NC1=C(C=CC=N1)CCCO[Si](C)(C)C(C)(C)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com