ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7126 CAS 1228665-73-3



5-FLUORO-4-(TRIMETHYLSILYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1228665-73-3
ID 7126

Molecular Formula   C10H13FN2Si
Molecular Weight     208.311
SmileCode               C[Si](C)(C)C1=C2C=CNC2=NC=C1F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com