ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7127 CAS 1228665-74-4



5-BROMO-2-(TRIMETHYLSILYL)FURO[2,3-B]PYRIDINE
CAS 1228665-74-4
ID 7127

Molecular Formula   C10H12BrNOSi
Molecular Weight     270.201
SmileCode               C[Si](C)(C)C1=CC2=CC(=CN=C2O1)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com