ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7130 CAS 1228665-81-3



TERT-BUTYL 3-((3-IODO-6-(PYRROLIDIN-1-YL)PYRIDIN-2-YLOXY)METHYL)PYRROLIDINE-1-CARBOXYLATE
CAS 1228665-81-3
ID 7130

Molecular Formula   C19H28IN3O3
Molecular Weight     473.355
SmileCode               CC(C)(C)OC(=O)N1CCC(C1)COC2=C(C=CC(=N2)N3CCCC3)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com