ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7132 CAS 1228665-86-8



TERT-BUTYL 3-(2-METHOXY-5-METHYLPYRIDIN-3-YL)PYRROLIDINE-1-CARBOXYLATE
CAS 1228665-86-8
ID 7132

Molecular Formula   C16H24N2O3
Molecular Weight     292.379
SmileCode               CC1=CN=C(C(=C1)C2CCN(C2)C(=O)OC(C)(C)C)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com