ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7133 CAS 1228665-88-0



2-FLUORO-3,4-DIIODO-6-(PYRROLIDIN-1-YL)PYRIDINE
CAS 1228665-88-0
ID 7133

Molecular Formula   C9H9FI2N2
Molecular Weight     417.992
SmileCode               C1CCN(C1)C2=NC(=C(C(=C2)I)I)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com