ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7135 CAS 1228665-90-4



4-CHLORO-5-FLUORO-3-IODO-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1228665-90-4
ID 7135

Molecular Formula   C7H3ClFIN2
Molecular Weight     296.468
SmileCode               C1=C(C2=C(C(=CN=C2N1)F)Cl)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com