ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7137 CAS 1228665-92-6



2,3-DIHYDRO-1H-PYRIDO[3,4-B][1,4]OXAZINE-8-CARBOXYLIC ACID
CAS 1228665-92-6
ID 7137

Molecular Formula   C8H8N2O3
Molecular Weight     180.163
SmileCode               C1COC2=C(N1)C(=CN=C2)C(=O)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com