ID 7139 CAS 1228665-94-8

CAS 1228665-94-8
ID 7139

Molecular Formula   C8H7NO4
Molecular Weight     181.147
SmileCode               C1COC2=NC=CC(=C2O1)C(=O)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock

Inquiry : contact[at]