ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7140 CAS 1228666-00-9



3-(1-BENZYLPYRROLIDIN-3-YL)-2-METHOXY-5-METHYLPYRIDINE
CAS 1228666-00-9
ID 7140

Molecular Formula   C18H22N2O
Molecular Weight     282.387
SmileCode               CC1=CN=C(C(=C1)C2CCN(C2)CC3=CC=CC=C3)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com