ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7143 CAS 1228666-03-2



5-BROMO-4-CHLORO-3-IODOPYRIDIN-2-AMINE
CAS 1228666-03-2
ID 7143

Molecular Formula   C5H3BrClIN2
Molecular Weight     333.351
SmileCode               C1=C(C(=C(C(=N1)N)I)Cl)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com