ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7144 CAS 1228666-06-5



3-IODO-2-METHOXY-6-(PYRROLIDIN-1-YL)PYRIDINE
CAS 1228666-06-5
ID 7144

Molecular Formula   C10H13IN2O
Molecular Weight     304.131
SmileCode               COC1=C(C=CC(=N1)N2CCCC2)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com