ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7145 CAS 1228666-07-6



3-IODO-5-METHYL-1-(PHENYLSULFONYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1228666-07-6
ID 7145

Molecular Formula   C14H11IN2O2S
Molecular Weight     398.218
SmileCode               CC1=CN=C2C(=C1)C(=CN2S(=O)(=O)C3=CC=CC=C3)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com