ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7146 CAS 1228666-08-7



5-FLUORO-1-(TRIISOPROPYLSILYL)-4-((TRIMETHYLSILYL)ETHYNYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1228666-08-7
ID 7146

Molecular Formula   C21H33FN2Si2
Molecular Weight     388.677
SmileCode               CC(C)[Si](C(C)C)(C(C)C)N1C=CC2=C(C(=CN=C21)F)C#C[Si](C)(C)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com