ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7147 CAS 1228666-09-8



2,2-DIMETHYL-1-(6-((TRIMETHYLSILYL)ETHYNYL)-2,3-DIHYDRO-1H-PYRIDO[2,3-B][1,4]OXAZIN-1-YL)PROPAN-1-ONE
CAS 1228666-09-8
ID 7147

Molecular Formula   C17H24N2O2Si
Molecular Weight     316.476
SmileCode               CC(C)(C)C(=O)N1CCOC2=C1C=CC(=N2)C#C[Si](C)(C)C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com