ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7148 CAS 1228666-12-3



5-BROMO-2-ETHYL-3-IODO-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1228666-12-3
ID 7148

Molecular Formula   C9H8BrIN2
Molecular Weight     350.985
SmileCode               CCC1=C(C2=CC(=CN=C2N1)Br)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com