ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7149 CAS 1228666-13-4



N-(3-IODO-5-METHYLPYRIDIN-2-YL)PIVALAMIDE
CAS 1228666-13-4
ID 7149

Molecular Formula   C11H15IN2O
Molecular Weight     318.158
SmileCode               CC1=CC(=C(N=C1)NC(=O)C(C)(C)C)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com