ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7151 CAS 1228666-15-6



3-ALLYL-2-METHOXY-6-(PYRROLIDIN-1-YL)PYRIDINE
CAS 1228666-15-6
ID 7151

Molecular Formula   C13H18N2O
Molecular Weight     218.300
SmileCode               COC1=C(C=CC(=N1)N2CCCC2)CC=C

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com