ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7152 CAS 1228666-16-7



6-IODO-7-METHYL-1H-PYRIDO[2,3-B][1,4]OXAZIN-2(3H)-ONE
CAS 1228666-16-7
ID 7152

Molecular Formula   C8H7IN2O2
Molecular Weight     290.060
SmileCode               CC1=CC2=C(N=C1I)OCC(=O)N2

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com