ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7154 CAS 1228666-20-3



3-BROMO-2-FLUORO-4-IODO-6-(PYRROLIDIN-1-YL)PYRIDINE
CAS 1228666-20-3
ID 7154

Molecular Formula   C9H9BrFIN2
Molecular Weight     370.992
SmileCode               C1CCN(C1)C2=NC(=C(C(=C2)I)Br)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com