ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7155 CAS 1228666-21-4



6-(3-((TERT-BUTYLDIMETHYLSILYLOXY)METHYL)PYRROLIDIN-1-YL)-2-FLUORONICOTINIC ACID
CAS 1228666-21-4
ID 7155

Molecular Formula   C17H27FN2O3Si
Molecular Weight     354.497
SmileCode               CC(C)(C)[Si](C)(C)OCC1CCN(C1)C2=NC(=C(C=C2)C(=O)O)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com