ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7157 CAS 1228666-23-6



5-FLUORO-3,4-DIIODO-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1228666-23-6
ID 7157

Molecular Formula   C7H3FI2N2
Molecular Weight     387.922
SmileCode               C1=C(C2=C(C(=CN=C2N1)F)I)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com