ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7163 CAS 1228666-35-0



5-(5-(BENZYLOXY)-6-BROMOPYRIDIN-2-YL)OXAZOLE
CAS 1228666-35-0
ID 7163

Molecular Formula   C15H11BrN2O2
Molecular Weight     331.169
SmileCode               C1=CC=C(C=C1)COC2=C(N=C(C=C2)C3=CN=CO3)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com