ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7167 CAS 1228666-41-8



5-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE-4-CARBOXYLIC ACID
CAS 1228666-41-8
ID 7167

Molecular Formula   C8H5FN2O2
Molecular Weight     180.138
SmileCode               C1=CNC2=NC=C(C(=C21)C(=O)O)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com