ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7168 CAS 1228666-42-9



TERT-BUTYL ((5-FLUORO-1H-PYRROLO[2,3-B]PYRIDIN-4-YL)METHYL)CARBAMATE
CAS 1228666-42-9
ID 7168

Molecular Formula   C13H16FN3O2
Molecular Weight     265.288
SmileCode               CC(C)(C)OC(=O)NCC1=C2C=CNC2=NC=C1F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com