ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7169 CAS 1228666-45-2



N-(5-BROMO-2-(3-HYDROXYPROP-1-YN-1-YL)PYRIDIN-3-YL)PIVALAMIDE
CAS 1228666-45-2
ID 7169

Molecular Formula   C13H15BrN2O2
Molecular Weight     311.179
SmileCode               CC(C)(C)C(=O)NC1=CC(=CN=C1C#CCO)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com