ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7170 CAS 1228666-46-3



5-FLUORO-2-PIVALAMIDONICOTINIC ACID
CAS 1228666-46-3
ID 7170

Molecular Formula   C11H13FN2O3
Molecular Weight     240.234
SmileCode               CC(C)(C)C(=O)NC1=NC=C(C=C1C(=O)O)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com