ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7172 CAS 1228666-48-5



1-TERT-BUTYL 3-METHYL 4-FORMYL-1H-PYRROLO[2,3-B]PYRIDINE-1,3-DICARBOXYLATE
CAS 1228666-48-5
ID 7172

Molecular Formula   C15H16N2O5
Molecular Weight     304.302
SmileCode               CC(C)(C)OC(=O)N1C=C(C2=C(C=CN=C21)C=O)C(=O)OC

Quantity | Price        5g | 4920 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com