ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7174 CAS 1228666-50-9



1-(6-(3-((TERT-BUTYLDIMETHYLSILYLOXY)METHYL)PYRROLIDIN-1-YL)-2-FLUOROPYRIDIN-3-YL)ETHANONE
CAS 1228666-50-9
ID 7174

Molecular Formula   C18H29FN2O2Si
Molecular Weight     352.525
SmileCode               CC(=O)C1=C(N=C(C=C1)N2CCC(C2)CO[Si](C)(C)C(C)(C)C)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com