ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7175 CAS 1228666-52-1



2-(3-((TERT-BUTYLDIMETHYLSILYLOXY)METHYL)PYRROLIDIN-1-YL)-6-(PYRROLIDIN-1-YL)PYRIDINE
CAS 1228666-52-1
ID 7175

Molecular Formula   C20H35N3OSi
Molecular Weight     361.605
SmileCode               CC(C)(C)[Si](C)(C)OCC1CCN(C1)C2=CC=CC(=N2)N3CCCC3

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com