ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7176 CAS 1228666-53-2



2-(DIMETHOXYMETHYL)-5-METHOXY-1,8-NAPHTHYRIDINE
CAS 1228666-53-2
ID 7176

Molecular Formula   C12H14N2O3
Molecular Weight     234.255
SmileCode               COC1=C2C=CC(=NC2=NC=C1)C(OC)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com