ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7178 CAS 1228666-57-6



6-(3-((TERT-BUTYLDIMETHYLSILYLOXY)METHYL)PYRROLIDIN-1-YL)-2-FLUORO-3-IODOPYRIDINE
CAS 1228666-57-6
ID 7178

Molecular Formula   C16H26FIN2OSi
Molecular Weight     436.385
SmileCode               CC(C)(C)[Si](C)(C)OCC1CCN(C1)C2=NC(=C(C=C2)I)F

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com