ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7185 CAS 1241950-73-1



2-ETHYL-1H-PYRROLO[2,3-B]PYRIDINE-5-CARBOXYLIC ACID
CAS 1241950-73-1
ID 7185

Molecular Formula   C10H10N2O2
Molecular Weight     190.202
SmileCode               CCC1=CC2=CC(=CN=C2N1)C(=O)O

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com