ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7187 CAS 1241950-75-3



2-CHLORO-4-IODO-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)PYRIDINE
CAS 1241950-75-3
ID 7187

Molecular Formula   C11H14BClINO2
Molecular Weight     365.402
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=C(C=CN=C2Cl)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com