ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7189 CAS 124432-61-7



2,3-DIMETHOXY-5-(TRIFLUOROMETHYL)PYRIDINE
CAS 124432-61-7
ID 7189

Molecular Formula   C8H8F3NO2
Molecular Weight     207.152
SmileCode               COC1=C(N=CC(=C1)C(F)(F)F)OC

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com