ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7190 CAS 1246088-36-7



5-BROMO-2-ETHYL-1-(TRIISOPROPYLSILYL)-1H-PYRROLO[2,3-B]PYRIDINE
CAS 1246088-36-7
ID 7190

Molecular Formula   C18H29BrN2Si
Molecular Weight     381.433
SmileCode               CCC1=CC2=CC(=CN=C2N1[Si](C(C)C)(C(C)C)C(C)C)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com