ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7193 CAS 1246088-39-0



N-(2-CYANO-5-FORMYLPYRIDIN-3-YL)PIVALAMIDE
CAS 1246088-39-0
ID 7193

Molecular Formula   C12H13N3O2
Molecular Weight     231.255
SmileCode               CC(C)(C)C(=O)NC1=C(N=CC(=C1)C=O)C#N

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com