ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7194 CAS 1246088-40-3



7-IODO-2,3-DIHYDRO-[1,4]DIOXINO[2,3-B]PYRIDIN-8-OL
CAS 1246088-40-3
ID 7194

Molecular Formula   C7H6INO3
Molecular Weight     279.033
SmileCode               C1COC2=C(O1)C(=O)C(=CN2)I

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com