ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 7197 CAS 1246088-44-7



N-(5-BROMO-2-CYANOPYRIDIN-3-YL)PIVALAMIDE
CAS 1246088-44-7
ID 7197

Molecular Formula   C11H12BrN3O
Molecular Weight     282.141
SmileCode               CC(C)(C)C(=O)NC1=CC(=CN=C1C#N)Br

Quantity | Price        5g | 3360 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com